C23H20F4N2O6S2 — CID 58651375
N-[(1S)-1-[4-[(E)-C-[2-(2-fluorophenyl)sulfonyl-4-(trifluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]phenyl]ethyl]methanesulfonamide (PubChem CID 58651375) has the molecular formula C23H20F4N2O6S2 and a molecular weight of 560.55 g/mol. Its IUPAC name is N-[(1S)-1-[4-[(E)-C-[2-(2-fluorophenyl)sulfonyl-4-(trifluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]phenyl]ethyl]methanesulfonamide.
| Compound Name | N-[(1S)-1-[4-[(E)-C-[2-(2-fluorophenyl)sulfonyl-4-(trifluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]phenyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 58651375 |
| Molecular Formula | C23H20F4N2O6S2 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | N-[(1S)-1-[4-[(E)-C-[2-(2-fluorophenyl)sulfonyl-4-(trifluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]phenyl]ethyl]methanesulfonamide |
| SMILES | C[C@H](NS(C)(=O)=O)c1ccc(/C(=N\O)c2ccc(OC(F)(F)F)cc2S(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C23H20F4N2O6S2/c1-14(29-36(2,31)32)15-7-9-16(10-8-15)22(28-30)18-12-11-17(35-23(25,26)27)13-21(18)37(33,34)20-6-4-3-5-19(20)24/h3-14,29-30H,1-2H3/b28-22+/t14-/m0/s1 |
| InChIKey | HBELFTXOKFFAMV-MOUZGGBRSA-N |
| XLogP | 4.39 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|