C29H40N6O5S — CID 58658509
tert-butyl N-[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-[2-(1H-indol-3-yl)ethylamino]-1-oxopentan-2-yl]-N-methylcarbamate (PubChem CID 58658509) has the molecular formula C29H40N6O5S and a molecular weight of 584.74 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-[2-(1H-indol-3-yl)ethylamino]-1-oxopentan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-[2-(1H-indol-3-yl)ethylamino]-1-oxopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58658509 |
| Molecular Formula | C29H40N6O5S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | tert-butyl N-[(2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-1-[2-(1H-indol-3-yl)ethylamino]-1-oxopentan-2-yl]-N-methylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N/C(N)=N/CCC[C@@H](C(=O)NCCc2c[nH]c3ccccc23)N(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H40N6O5S/c1-20-12-14-22(15-13-20)41(38,39)34-27(30)32-17-8-11-25(35(5)28(37)40-29(2,3)4)26(36)31-18-16-21-19-33-24-10-7-6-9-23(21)24/h6-7,9-10,12-15,19,25,33H,8,11,16-18H2,1-5H3,(H,31,36)(H3,30,32,34)/t25-/m0/s1 |
| InChIKey | SWOABCBYBXFCFS-VWLOTQADSA-N |
| XLogP | 3.44 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|