C16H11ClN2O5S — CID 58659587
methyl 2-[4-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-1,3-thiazol-2-yl]acetate (PubChem CID 58659587) has the molecular formula C16H11ClN2O5S and a molecular weight of 378.79 g/mol. Its IUPAC name is methyl 2-[4-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-1,3-thiazol-2-yl]acetate.
| Compound Name | methyl 2-[4-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-1,3-thiazol-2-yl]acetate |
|---|---|
| PubChem CID | 58659587 |
| Molecular Formula | C16H11ClN2O5S |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | methyl 2-[4-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-1,3-thiazol-2-yl]acetate |
| SMILES | COC(=O)Cc1nc(-c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)cs1 |
| InChI | InChI=1S/C16H11ClN2O5S/c1-23-16(20)7-15-18-12(8-25-15)14-5-4-13(24-14)10-3-2-9(19(21)22)6-11(10)17/h2-6,8H,7H2,1H3 |
| InChIKey | ZJHAEPCSYRTBII-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|