C15H29Y- — CID 58666238
(Z)-2,2,3,3,6,6,7-heptamethyloct-4-ene;yttrium (PubChem CID 58666238) has the molecular formula C15H29Y- and a molecular weight of 298.30 g/mol. Its IUPAC name is (Z)-2,2,3,3,6,6,7-heptamethyloct-4-ene;yttrium.
| Compound Name | (Z)-2,2,3,3,6,6,7-heptamethyloct-4-ene;yttrium |
|---|---|
| PubChem CID | 58666238 |
| Molecular Formula | C15H29Y- |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (Z)-2,2,3,3,6,6,7-heptamethyloct-4-ene;yttrium |
| SMILES | C[C-](C)C(C)(C)/C=C\C(C)(C)C(C)(C)C.[Y] |
| InChI | InChI=1S/C15H29.Y/c1-12(2)14(6,7)10-11-15(8,9)13(3,4)5;/h10-11H,1-9H3;/q-1;/b11-10-; |
| InChIKey | JUHMOZDWCFYRQO-GMFCBQQYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|