C10H14BClN2O — CID 58668997
(2-chloro-5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)-methylborinic acid (PubChem CID 58668997) has the molecular formula C10H14BClN2O and a molecular weight of 224.50 g/mol. Its IUPAC name is (2-chloro-5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)-methylborinic acid.
| Compound Name | (2-chloro-5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)-methylborinic acid |
|---|---|
| PubChem CID | 58668997 |
| Molecular Formula | C10H14BClN2O |
| Molecular Weight | 224.50 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (2-chloro-5,6,7,8-tetrahydropyrido[2,3-b]azepin-9-yl)-methylborinic acid |
| SMILES | CB(O)N1CCCCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C10H14BClN2O/c1-11(15)14-7-3-2-4-8-5-6-9(12)13-10(8)14/h5-6,15H,2-4,7H2,1H3 |
| InChIKey | MYCFFSZFOYRBFJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|