C46H70O16Si — CID 58675293
2-methoxyethyl 6-[[6-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-6-oxohexoxy]-[8-[4-(2-hydroxy-2-methylpropanoyl)phenyl]peroxy-6-oxooctoxy]-methylsilyl]oxyhexanoate (PubChem CID 58675293) has the molecular formula C46H70O16Si and a molecular weight of 907.14 g/mol. Its IUPAC name is 2-methoxyethyl 6-[[6-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-6-oxohexoxy]-[8-[4-(2-hydroxy-2-methylpropanoyl)phenyl]peroxy-6-oxooctoxy]-methylsilyl]oxyhexanoate.
| Compound Name | 2-methoxyethyl 6-[[6-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-6-oxohexoxy]-[8-[4-(2-hydroxy-2-methylpropanoyl)phenyl]peroxy-6-oxooctoxy]-methylsilyl]oxyhexanoate |
|---|---|
| PubChem CID | 58675293 |
| Molecular Formula | C46H70O16Si |
| Molecular Weight | 907.14 g/mol |
| Exact Mass | 906.44 |
| IUPAC Name | 2-methoxyethyl 6-[[6-[2-[4-(2-hydroxy-2-methylpropanoyl)phenoxy]ethoxy]-6-oxohexoxy]-[8-[4-(2-hydroxy-2-methylpropanoyl)phenyl]peroxy-6-oxooctoxy]-methylsilyl]oxyhexanoate |
| SMILES | COCCOC(=O)CCCCCO[Si](C)(OCCCCCC(=O)CCOOc1ccc(C(=O)C(C)(C)O)cc1)OCCCCCC(=O)OCCOc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C46H70O16Si/c1-45(2,52)43(50)36-19-23-39(24-20-36)55-34-35-57-42(49)18-12-9-15-30-61-63(6,60-29-14-8-11-17-41(48)56-33-32-54-5)59-28-13-7-10-16-38(47)27-31-58-62-40-25-21-37(22-26-40)44(51)46(3,4)53/h19-26,52-53H,7-18,27-35H2,1-6H3 |
| InChIKey | GSMPVJXFCBDHEE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 208.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.14 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|