C13H17N4O5PS — CID 58681742
[(1S,13S,14R)-7-methyl-11-oxo-11λ4-thia-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3,5,7,9-tetraen-14-yl]methyl dihydrogen phosphate (PubChem CID 58681742) has the molecular formula C13H17N4O5PS and a molecular weight of 372.34 g/mol. Its IUPAC name is [(1S,13S,14R)-7-methyl-11-oxo-11λ4-thia-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3,5,7,9-tetraen-14-yl]methyl dihydrogen phosphate.
| Compound Name | [(1S,13S,14R)-7-methyl-11-oxo-11λ4-thia-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3,5,7,9-tetraen-14-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58681742 |
| Molecular Formula | C13H17N4O5PS |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [(1S,13S,14R)-7-methyl-11-oxo-11λ4-thia-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3,5,7,9-tetraen-14-yl]methyl dihydrogen phosphate |
| SMILES | Cc1ncnc2c1nc1n2[C@H]2C[C@@H](COP(=O)(O)O)[C@H](C2)CS1=O |
| InChI | InChI=1S/C13H17N4O5PS/c1-7-11-12(15-6-14-7)17-10-2-8(4-22-23(18,19)20)9(3-10)5-24(21)13(17)16-11/h6,8-10H,2-5H2,1H3,(H2,18,19,20)/t8-,9+,10-,24?/m0/s1 |
| InChIKey | PQMILAOAUVODRW-HLOFHESESA-N |
| XLogP | 0.93 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|