C27H26N4O — CID 58705021
(2E)-2-[(3E)-3-(5-isocyano-1,3,3-trimethylindol-2-ylidene)-2-oxopropylidene]-1,3,3-trimethylindole-5-carbonitrile (PubChem CID 58705021) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is (2E)-2-[(3E)-3-(5-isocyano-1,3,3-trimethylindol-2-ylidene)-2-oxopropylidene]-1,3,3-trimethylindole-5-carbonitrile.
| Compound Name | (2E)-2-[(3E)-3-(5-isocyano-1,3,3-trimethylindol-2-ylidene)-2-oxopropylidene]-1,3,3-trimethylindole-5-carbonitrile |
|---|---|
| PubChem CID | 58705021 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (2E)-2-[(3E)-3-(5-isocyano-1,3,3-trimethylindol-2-ylidene)-2-oxopropylidene]-1,3,3-trimethylindole-5-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)/C(=C\C(=O)/C=C1/N(C)c3ccc(C#N)cc3C1(C)C)N2C |
| InChI | InChI=1S/C27H26N4O/c1-26(2)20-12-17(16-28)8-10-22(20)30(6)24(26)14-19(32)15-25-27(3,4)21-13-18(29-5)9-11-23(21)31(25)7/h8-15H,1-4,6-7H3/b24-14+,25-15+ |
| InChIKey | KCCYPRZRTLMHAR-KOJZRSEWSA-N |
| XLogP | 5.60 |
| TPSA | 51.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|