C14H18ClN5O7S2 — CID 58708512
2-[[4-chloro-6-[ethyl(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-4-methyl-5-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 58708512) has the molecular formula C14H18ClN5O7S2 and a molecular weight of 467.91 g/mol. Its IUPAC name is 2-[[4-chloro-6-[ethyl(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-4-methyl-5-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 2-[[4-chloro-6-[ethyl(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-4-methyl-5-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 58708512 |
| Molecular Formula | C14H18ClN5O7S2 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-[[4-chloro-6-[ethyl(2-hydroxyethyl)amino]-1,3,5-triazin-2-yl]amino]-4-methyl-5-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | CCN(CCO)c1nc(Cl)nc(Nc2cc(C)c(SOOO)cc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C14H18ClN5O7S2/c1-3-20(4-5-21)14-18-12(15)17-13(19-14)16-9-6-8(2)10(28-27-26-22)7-11(9)29(23,24)25/h6-7,21-22H,3-5H2,1-2H3,(H,23,24,25)(H,16,17,18,19) |
| InChIKey | GBXGWEBPTAVKIK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 167.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|