About 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide
10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide (PubChem CID 58711377) has the molecular formula C19H15O3S3+
and a molecular weight of 387.53 g/mol. Its IUPAC name is 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide.
Molecular Properties
| Compound Name | 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide |
| PubChem CID | 58711377 |
| Molecular Formula | C19H15O3S3+ |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide |
| SMILES | CS(=O)(=O)c1ccc([S+]2c3ccccc3S(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H15O3S3/c1-25(21,22)15-12-10-14(11-13-15)23-16-6-2-4-8-18(16)24(20)19-9-5-3-7-17(19)23/h2-13H,1H3/q+1 |
| InChIKey | FIAFDEZQYLSBQS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide?
The IUPAC name of 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide (CID 58711377) is 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide.
What is the SMILES notation for 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide?
The canonical SMILES for 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide is CS(=O)(=O)c1ccc([S+]2c3ccccc3S(=O)c3ccccc32)cc1.
What is the InChIKey of 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide?
The InChIKey is FIAFDEZQYLSBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15O3S3/c1-25(21,22)15-12-10-14(11-13-15)23-16-6-2-4-8-18(16)24(20)19-9-5-3-7-17(19)23/h2-13H,1H3/q+1.
What are the key properties of 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide?
10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide has a molecular weight of 387.53 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-methylsulfonylphenyl)thianthren-10-ium 5-oxide is sourced from PubChem (CID 58711377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).