C13H24N2 — CID 58720054
5-tert-butyl-1,3,4-triethylpyrazole (PubChem CID 58720054) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 5-tert-butyl-1,3,4-triethylpyrazole.
| Compound Name | 5-tert-butyl-1,3,4-triethylpyrazole |
|---|---|
| PubChem CID | 58720054 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 5-tert-butyl-1,3,4-triethylpyrazole |
| SMILES | CCc1nn(CC)c(C(C)(C)C)c1CC |
| InChI | InChI=1S/C13H24N2/c1-7-10-11(8-2)14-15(9-3)12(10)13(4,5)6/h7-9H2,1-6H3 |
| InChIKey | JUDNBPROHMDYKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |