C55H56N4O2 — CID 58734357
2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-5-[9-(5-methyl-1,3,4-oxadiazol-2-yl)perylen-3-yl]-1,3,4-oxadiazole (PubChem CID 58734357) has the molecular formula C55H56N4O2 and a molecular weight of 805.08 g/mol. Its IUPAC name is 2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-5-[9-(5-methyl-1,3,4-oxadiazol-2-yl)perylen-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-5-[9-(5-methyl-1,3,4-oxadiazol-2-yl)perylen-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 58734357 |
| Molecular Formula | C55H56N4O2 |
| Molecular Weight | 805.08 g/mol |
| Exact Mass | 804.44 |
| IUPAC Name | 2-[9,9-bis(2-ethylhexyl)-7-methylfluoren-2-yl]-5-[9-(5-methyl-1,3,4-oxadiazol-2-yl)perylen-3-yl]-1,3,4-oxadiazole |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(C)ccc2-c2ccc(-c3nnc(-c4ccc5c6cccc7c(-c8nnc(C)o8)ccc(c8cccc4c85)c76)o3)cc21 |
| InChI | InChI=1S/C55H56N4O2/c1-7-11-15-35(9-3)31-55(32-36(10-4)16-12-8-2)48-29-33(5)21-23-38(48)39-24-22-37(30-49(39)55)52-57-59-54(61-52)47-28-26-45-40-17-13-19-42-46(53-58-56-34(6)60-53)27-25-44(50(40)42)41-18-14-20-43(47)51(41)45/h13-14,17-30,35-36H,7-12,15-16,31-32H2,1-6H3 |
| InChIKey | HMLONLYMTZCAIP-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.08 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|