C19H15ClN2O2 — CID 58740787
(E)-3-[4-[(5-chloro-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]prop-2-enoic acid (PubChem CID 58740787) has the molecular formula C19H15ClN2O2 and a molecular weight of 338.79 g/mol. Its IUPAC name is (E)-3-[4-[(5-chloro-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(5-chloro-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58740787 |
| Molecular Formula | C19H15ClN2O2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (E)-3-[4-[(5-chloro-4-phenyl-1H-imidazol-2-yl)methyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(Cc2nc(-c3ccccc3)c(Cl)[nH]2)cc1 |
| InChI | InChI=1S/C19H15ClN2O2/c20-19-18(15-4-2-1-3-5-15)21-16(22-19)12-14-8-6-13(7-9-14)10-11-17(23)24/h1-11H,12H2,(H,21,22)(H,23,24)/b11-10+ |
| InChIKey | ICLBYXBWLYQRNT-ZHACJKMWSA-N |
| XLogP | 4.42 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|