C30H41N5O7S — CID 58746830
tert-butyl N-[(2S)-1-oxo-1-[[(2S)-1-oxo-1-(pentylamino)-3-[4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propan-2-yl]amino]-3-phenylpropan-2-yl]carbamate (PubChem CID 58746830) has the molecular formula C30H41N5O7S and a molecular weight of 615.75 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-1-[[(2S)-1-oxo-1-(pentylamino)-3-[4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propan-2-yl]amino]-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-oxo-1-[[(2S)-1-oxo-1-(pentylamino)-3-[4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propan-2-yl]amino]-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58746830 |
| Molecular Formula | C30H41N5O7S |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-1-[[(2S)-1-oxo-1-(pentylamino)-3-[4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propan-2-yl]amino]-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(N2CC(=O)NS2(=O)=O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41N5O7S/c1-5-6-10-17-31-27(37)24(19-22-13-15-23(16-14-22)35-20-26(36)34-43(35,40)41)32-28(38)25(18-21-11-8-7-9-12-21)33-29(39)42-30(2,3)4/h7-9,11-16,24-25H,5-6,10,17-20H2,1-4H3,(H,31,37)(H,32,38)(H,33,39)(H,34,36)/t24-,25-/m0/s1 |
| InChIKey | PCDVQEMWFXFTJY-DQEYMECFSA-N |
| XLogP | 2.34 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|