C27H43N5 — CID 58758475
(5S,7R,22R,24S)-6,13,16,23,30-pentazahexacyclo[26.3.1.05,31.07,12.017,22.024,29]dotriaconta-1(32),28,30-triene (PubChem CID 58758475) has the molecular formula C27H43N5 and a molecular weight of 437.68 g/mol. Its IUPAC name is (5S,7R,22R,24S)-6,13,16,23,30-pentazahexacyclo[26.3.1.05,31.07,12.017,22.024,29]dotriaconta-1(32),28,30-triene.
| Compound Name | (5S,7R,22R,24S)-6,13,16,23,30-pentazahexacyclo[26.3.1.05,31.07,12.017,22.024,29]dotriaconta-1(32),28,30-triene |
|---|---|
| PubChem CID | 58758475 |
| Molecular Formula | C27H43N5 |
| Molecular Weight | 437.68 g/mol |
| Exact Mass | 437.35 |
| IUPAC Name | (5S,7R,22R,24S)-6,13,16,23,30-pentazahexacyclo[26.3.1.05,31.07,12.017,22.024,29]dotriaconta-1(32),28,30-triene |
| SMILES | c1c2c3nc4c1CCC[C@@H]4N[C@@H]1CCCCC1NCCNC1CCCC[C@H]1N[C@H]3CCC2 |
| InChI | InChI=1S/C27H43N5/c1-3-11-22-20(9-1)28-15-16-29-21-10-2-4-12-23(21)31-25-14-6-8-19-17-18-7-5-13-24(30-22)26(18)32-27(19)25/h17,20-25,28-31H,1-16H2/t20?,21?,22-,23-,24+,25+/m1/s1 |
| InChIKey | LMJGSRGGFREWOK-XEHGCQFQSA-N |
| XLogP | 3.83 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |