C34H49N5 — CID 58795124
CID 58795124 (PubChem CID 58795124) has the molecular formula C34H49N5 and a molecular weight of 527.80 g/mol.
| Compound Name | CID 58795124 |
|---|---|
| PubChem CID | 58795124 |
| Molecular Formula | C34H49N5 |
| Molecular Weight | 527.80 g/mol |
| Exact Mass | 527.40 |
| IUPAC Name | — |
| SMILES | [CH2-][n+]1c2c3c(-c4ccccc4)c4c1C(CCC4)NC1CCCCC1NCCNC1CCCCC1NC2CCC3 |
| InChI | InChI=1S/C34H49N5/c1-39-33-24-13-9-19-30(33)37-28-17-7-5-15-26(28)35-21-22-36-27-16-6-8-18-29(27)38-31-20-10-14-25(34(31)39)32(24)23-11-3-2-4-12-23/h2-4,11-12,26-31,35-38H,1,5-10,13-22H2 |
| InChIKey | QOQCEVBGHGKWKC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|