C22H33NO4S — CID 58770077
4-[2-[(2R)-2-[3-hydroxy-4-(2-methylphenyl)butyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid (PubChem CID 58770077) has the molecular formula C22H33NO4S and a molecular weight of 407.58 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[3-hydroxy-4-(2-methylphenyl)butyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid.
| Compound Name | 4-[2-[(2R)-2-[3-hydroxy-4-(2-methylphenyl)butyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 58770077 |
| Molecular Formula | C22H33NO4S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 4-[2-[(2R)-2-[3-hydroxy-4-(2-methylphenyl)butyl]-6-oxopiperidin-1-yl]ethylsulfanyl]butanoic acid |
| SMILES | Cc1ccccc1CC(O)CC[C@H]1CCCC(=O)N1CCSCCCC(=O)O |
| InChI | InChI=1S/C22H33NO4S/c1-17-6-2-3-7-18(17)16-20(24)12-11-19-8-4-9-21(25)23(19)13-15-28-14-5-10-22(26)27/h2-3,6-7,19-20,24H,4-5,8-16H2,1H3,(H,26,27)/t19-,20?/m1/s1 |
| InChIKey | HTKWBEWWCXAWLR-FIWHBWSRSA-N |
| XLogP | 3.66 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|