C15H26O6Si — CID 58773637
9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,4-dioxaspiro[4.5]dec-9-en-8-one (PubChem CID 58773637) has the molecular formula C15H26O6Si and a molecular weight of 330.45 g/mol. Its IUPAC name is 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,4-dioxaspiro[4.5]dec-9-en-8-one.
| Compound Name | 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,4-dioxaspiro[4.5]dec-9-en-8-one |
|---|---|
| PubChem CID | 58773637 |
| Molecular Formula | C15H26O6Si |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 9-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,4-dioxaspiro[4.5]dec-9-en-8-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC2(OCCO2)C(O)C(O)C1=O |
| InChI | InChI=1S/C15H26O6Si/c1-14(2,3)22(4,5)21-9-10-8-15(19-6-7-20-15)13(18)12(17)11(10)16/h8,12-13,17-18H,6-7,9H2,1-5H3 |
| InChIKey | GBVOTXDEKDQUNE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|