C21H20ClFN2O2 — CID 58779013
N-[2-chloro-4-(3-methyl-2-oxobutyl)phenyl]-4-fluoro-1-methylindole-3-carboxamide (PubChem CID 58779013) has the molecular formula C21H20ClFN2O2 and a molecular weight of 386.85 g/mol. Its IUPAC name is N-[2-chloro-4-(3-methyl-2-oxobutyl)phenyl]-4-fluoro-1-methylindole-3-carboxamide.
| Compound Name | N-[2-chloro-4-(3-methyl-2-oxobutyl)phenyl]-4-fluoro-1-methylindole-3-carboxamide |
|---|---|
| PubChem CID | 58779013 |
| Molecular Formula | C21H20ClFN2O2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-[2-chloro-4-(3-methyl-2-oxobutyl)phenyl]-4-fluoro-1-methylindole-3-carboxamide |
| SMILES | CC(C)C(=O)Cc1ccc(NC(=O)c2cn(C)c3cccc(F)c23)c(Cl)c1 |
| InChI | InChI=1S/C21H20ClFN2O2/c1-12(2)19(26)10-13-7-8-17(15(22)9-13)24-21(27)14-11-25(3)18-6-4-5-16(23)20(14)18/h4-9,11-12H,10H2,1-3H3,(H,24,27) |
| InChIKey | FRSPJTKNYDDLSX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |