C32H42N2O8S — CID 58779201
[(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-prop-2-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 58779201) has the molecular formula C32H42N2O8S and a molecular weight of 614.76 g/mol. Its IUPAC name is [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-prop-2-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-prop-2-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58779201 |
| Molecular Formula | C32H42N2O8S |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-prop-2-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | C=CCCCCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCCC21)S(=O)(=O)c1cccc(OCC=C)c1 |
| InChI | InChI=1S/C32H42N2O8S/c1-3-5-6-10-17-34(43(37,38)26-15-11-14-25(21-26)39-18-4-2)22-29(35)28(20-24-12-8-7-9-13-24)33-32(36)42-30-23-41-31-27(30)16-19-40-31/h3-4,7-9,11-15,21,27-31,35H,1-2,5-6,10,16-20,22-23H2,(H,33,36)/t27?,28-,29+,30-,31+/m0/s1 |
| InChIKey | QCDOIZDOKNIRKC-URCOKFGLSA-N |
| XLogP | 4.06 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|