C34H46N2O8S — CID 58779281
[(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-pent-4-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 58779281) has the molecular formula C34H46N2O8S and a molecular weight of 642.82 g/mol. Its IUPAC name is [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-pent-4-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-pent-4-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58779281 |
| Molecular Formula | C34H46N2O8S |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | [(4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[hex-5-enyl-(3-pent-4-enoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | C=CCCCCN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCCC21)S(=O)(=O)c1cccc(OCCCC=C)c1 |
| InChI | InChI=1S/C34H46N2O8S/c1-3-5-7-11-19-36(45(39,40)28-17-13-16-27(23-28)41-20-12-6-4-2)24-31(37)30(22-26-14-9-8-10-15-26)35-34(38)44-32-25-43-33-29(32)18-21-42-33/h3-4,8-10,13-17,23,29-33,37H,1-2,5-7,11-12,18-22,24-25H2,(H,35,38)/t29?,30-,31+,32-,33+/m0/s1 |
| InChIKey | RJFCYYRHQNKQRR-FEEDHTTJSA-N |
| XLogP | 4.84 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|