C13H15F7O2 — CID 58782385
5-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-fluorobicyclo[2.2.1]hept-2-ene (PubChem CID 58782385) has the molecular formula C13H15F7O2 and a molecular weight of 336.25 g/mol. Its IUPAC name is 5-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-fluorobicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-fluorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58782385 |
| Molecular Formula | C13H15F7O2 |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5-fluorobicyclo[2.2.1]hept-2-ene |
| SMILES | CCOCOC(C(F)(F)F)(C(F)(F)F)C1(F)CC2C=CC1C2 |
| InChI | InChI=1S/C13H15F7O2/c1-2-21-7-22-11(12(15,16)17,13(18,19)20)10(14)6-8-3-4-9(10)5-8/h3-4,8-9H,2,5-7H2,1H3 |
| InChIKey | BSKPDGZBYQWUAC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|