C38H22O6 — CID 58785377
2,6-bis[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol (PubChem CID 58785377) has the molecular formula C38H22O6 and a molecular weight of 574.59 g/mol. Its IUPAC name is 2,6-bis[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol.
| Compound Name | 2,6-bis[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 58785377 |
| Molecular Formula | C38H22O6 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 2,6-bis[2-[3-[2-(2,5-dihydroxyphenyl)ethynyl]phenyl]ethynyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(C#Cc2cccc(C#Cc3cc(O)cc(C#Cc4cccc(C#Cc5cc(O)ccc5O)c4)c3O)c2)c1 |
| InChI | InChI=1S/C38H22O6/c39-33-15-17-36(42)29(21-33)11-7-25-3-1-5-27(19-25)9-13-31-23-35(41)24-32(38(31)44)14-10-28-6-2-4-26(20-28)8-12-30-22-34(40)16-18-37(30)43/h1-6,15-24,39-44H |
| InChIKey | XUWSUYGXPIROCA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|