C25H31NaO5S — CID 58819344
sodium 4-(4-carboxy-10-phenyldodec-7-en-2-yl)benzenesulfonate (PubChem CID 58819344) has the molecular formula C25H31NaO5S and a molecular weight of 466.58 g/mol. Its IUPAC name is sodium 4-(4-carboxy-10-phenyldodec-7-en-2-yl)benzenesulfonate.
| Compound Name | sodium 4-(4-carboxy-10-phenyldodec-7-en-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 58819344 |
| Molecular Formula | C25H31NaO5S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | sodium 4-(4-carboxy-10-phenyldodec-7-en-2-yl)benzenesulfonate |
| SMILES | CCC(CC=CCCC(CC(C)c1ccc(S(=O)(=O)[O-])cc1)C(=O)O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C25H32O5S.Na/c1-3-20(22-11-7-5-8-12-22)10-6-4-9-13-23(25(26)27)18-19(2)21-14-16-24(17-15-21)31(28,29)30;/h4-8,11-12,14-17,19-20,23H,3,9-10,13,18H2,1-2H3,(H,26,27)(H,28,29,30);/q;+1/p-1 |
| InChIKey | GSOCDBZFXJZIAG-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|