C9H7N3 — CID 58826660
6-isocyano-3-methyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58826660) has the molecular formula C9H7N3 and a molecular weight of 157.18 g/mol. Its IUPAC name is 6-isocyano-3-methyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 6-isocyano-3-methyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58826660 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 6-isocyano-3-methyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | [C-]#[N+]c1ccc2c(C)c[nH]c2n1 |
| InChI | InChI=1S/C9H7N3/c1-6-5-11-9-7(6)3-4-8(10-2)12-9/h3-5H,1H3,(H,11,12) |
| InChIKey | ANHOOYLPCBIYLW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|