C7H8N4 — CID 162683037
5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-amine (PubChem CID 162683037) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-amine.
| Compound Name | 5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-amine |
|---|---|
| PubChem CID | 162683037 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 5-methyl-7H-pyrrolo[2,3-c]pyridazin-3-amine |
| SMILES | Cc1c[nH]c2nnc(N)cc12 |
| InChI | InChI=1S/C7H8N4/c1-4-3-9-7-5(4)2-6(8)10-11-7/h2-3H,1H3,(H2,8,10)(H,9,11) |
| InChIKey | ZNRCHKKJGXYBQW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |