C20H22F4N8O2 — CID 58877174
1-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-[3-(trifluoromethyl)anilino]piperazin-2-one (PubChem CID 58877174) has the molecular formula C20H22F4N8O2 and a molecular weight of 482.44 g/mol. Its IUPAC name is 1-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-[3-(trifluoromethyl)anilino]piperazin-2-one.
| Compound Name | 1-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-[3-(trifluoromethyl)anilino]piperazin-2-one |
|---|---|
| PubChem CID | 58877174 |
| Molecular Formula | C20H22F4N8O2 |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 1-[(E)-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)hydrazinylidene]methyl]-4-[3-(trifluoromethyl)anilino]piperazin-2-one |
| SMILES | O=C1CN(Nc2cccc(C(F)(F)F)c2)CCN1/C=N/Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H22F4N8O2/c21-16-11-25-19(27-18(16)30-6-8-34-9-7-30)28-26-13-31-4-5-32(12-17(31)33)29-15-3-1-2-14(10-15)20(22,23)24/h1-3,10-11,13,29H,4-9,12H2,(H,25,27,28)/b26-13+ |
| InChIKey | IHCDNRMRHARLNX-LGJNPRDNSA-N |
| XLogP | 2.00 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|