C30H36ClNO10S — CID 58882395
(2S,3S,4S,5R)-6-[(E)-1-[(2R)-1-[(Z)-6-carboxyhex-2-enyl]-5-oxopyrrolidin-2-yl]-5-(3-chloro-1-benzothiophen-2-yl)pent-1-en-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 58882395) has the molecular formula C30H36ClNO10S and a molecular weight of 638.14 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[(E)-1-[(2R)-1-[(Z)-6-carboxyhex-2-enyl]-5-oxopyrrolidin-2-yl]-5-(3-chloro-1-benzothiophen-2-yl)pent-1-en-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[(E)-1-[(2R)-1-[(Z)-6-carboxyhex-2-enyl]-5-oxopyrrolidin-2-yl]-5-(3-chloro-1-benzothiophen-2-yl)pent-1-en-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 58882395 |
| Molecular Formula | C30H36ClNO10S |
| Molecular Weight | 638.14 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | (2S,3S,4S,5R)-6-[(E)-1-[(2R)-1-[(Z)-6-carboxyhex-2-enyl]-5-oxopyrrolidin-2-yl]-5-(3-chloro-1-benzothiophen-2-yl)pent-1-en-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)CCC/C=C\CN1C(=O)CC[C@@H]1/C=C/C(CCc1sc2ccccc2c1Cl)OC1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C30H36ClNO10S/c31-24-19-7-4-5-8-20(19)43-21(24)14-13-18(41-30-27(38)25(36)26(37)28(42-30)29(39)40)12-10-17-11-15-22(33)32(17)16-6-2-1-3-9-23(34)35/h2,4-8,10,12,17-18,25-28,30,36-38H,1,3,9,11,13-16H2,(H,34,35)(H,39,40)/b6-2-,12-10+/t17-,18?,25-,26-,27+,28-,30?/m0/s1 |
| InChIKey | SXRSYCYZLFBOBJ-SNGPVTCGSA-N |
| XLogP | 3.12 |
| TPSA | 174.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|