C11H15F7N4O3 — CID 58883041
N-[2-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamoyl fluoride (PubChem CID 58883041) has the molecular formula C11H15F7N4O3 and a molecular weight of 384.25 g/mol. Its IUPAC name is N-[2-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamoyl fluoride.
| Compound Name | N-[2-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 58883041 |
| Molecular Formula | C11H15F7N4O3 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[2-[bis[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]carbamoyl fluoride |
| SMILES | O=C(F)NCCN(CCNC(=O)C(F)(F)F)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F7N4O3/c12-9(25)21-3-6-22(4-1-19-7(23)10(13,14)15)5-2-20-8(24)11(16,17)18/h1-6H2,(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | DWANMIAJUHDVAL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|