C25H44O8SSi2 — CID 58922361
[(6aS,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-8-tritio-6,8,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-6a-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58922361) has the molecular formula C25H44O8SSi2 and a molecular weight of 562.87 g/mol. Its IUPAC name is [(6aS,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-8-tritio-6,8,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-6a-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(6aS,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-8-tritio-6,8,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-6a-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58922361 |
| Molecular Formula | C25H44O8SSi2 |
| Molecular Weight | 562.87 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | [(6aS,9R)-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-8-tritio-6,8,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocin-6a-yl]methyl 4-methylbenzenesulfonate |
| SMILES | [3H]C1O[C@]2(COS(=O)(=O)c3ccc(C)cc3)CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC2[C@@H]1O |
| InChI | InChI=1S/C25H44O8SSi2/c1-17(2)35(18(3)4)31-16-25(15-30-34(27,28)22-12-10-21(9)11-13-22)24(23(26)14-29-25)32-36(33-35,19(5)6)20(7)8/h10-13,17-20,23-24,26H,14-16H2,1-9H3/t23-,24?,25-/m1/s1/i14T/t14?,23-,24?,25- |
| InChIKey | KKNSOEQIENWSPH-SBUWAFBWSA-N |
| XLogP | 4.79 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.87 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|