C26H24N2O4S2 — CID 58937155
methyl 2-ethyl-5-[[4-(quinolin-2-ylmethylsulfanyl)phenyl]sulfamoyl]benzoate (PubChem CID 58937155) has the molecular formula C26H24N2O4S2 and a molecular weight of 492.62 g/mol. Its IUPAC name is methyl 2-ethyl-5-[[4-(quinolin-2-ylmethylsulfanyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 2-ethyl-5-[[4-(quinolin-2-ylmethylsulfanyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 58937155 |
| Molecular Formula | C26H24N2O4S2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | methyl 2-ethyl-5-[[4-(quinolin-2-ylmethylsulfanyl)phenyl]sulfamoyl]benzoate |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(SCc3ccc4ccccc4n3)cc2)cc1C(=O)OC |
| InChI | InChI=1S/C26H24N2O4S2/c1-3-18-9-15-23(16-24(18)26(29)32-2)34(30,31)28-20-11-13-22(14-12-20)33-17-21-10-8-19-6-4-5-7-25(19)27-21/h4-16,28H,3,17H2,1-2H3 |
| InChIKey | KXFZXLLSWTZOOH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |