C30H39F3O — CID 58953282
3-(difluoromethyl)-1-(4-ethoxyphenyl)-2-fluoro-4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]benzene (PubChem CID 58953282) has the molecular formula C30H39F3O and a molecular weight of 472.64 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-(4-ethoxyphenyl)-2-fluoro-4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]benzene.
| Compound Name | 3-(difluoromethyl)-1-(4-ethoxyphenyl)-2-fluoro-4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]benzene |
|---|---|
| PubChem CID | 58953282 |
| Molecular Formula | C30H39F3O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 3-(difluoromethyl)-1-(4-ethoxyphenyl)-2-fluoro-4-[(E)-4-(4-pentylcyclohexyl)but-1-enyl]benzene |
| SMILES | CCCCCC1CCC(CC/C=C/c2ccc(-c3ccc(OCC)cc3)c(F)c2C(F)F)CC1 |
| InChI | InChI=1S/C30H39F3O/c1-3-5-6-9-22-12-14-23(15-13-22)10-7-8-11-25-18-21-27(29(31)28(25)30(32)33)24-16-19-26(20-17-24)34-4-2/h8,11,16-23,30H,3-7,9-10,12-15H2,1-2H3/b11-8+ |
| InChIKey | FDVSZIGNLIWCDH-DHZHZOJOSA-N |
| XLogP | 10.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|