C19H20N6 — CID 58955207
(2Z)-2-[2-(cyclopropylamino)-5-methylpyrimidin-4-yl]-2-(3-ethyl-1H-benzimidazol-2-ylidene)acetonitrile (PubChem CID 58955207) has the molecular formula C19H20N6 and a molecular weight of 332.41 g/mol. Its IUPAC name is (2Z)-2-[2-(cyclopropylamino)-5-methylpyrimidin-4-yl]-2-(3-ethyl-1H-benzimidazol-2-ylidene)acetonitrile.
| Compound Name | (2Z)-2-[2-(cyclopropylamino)-5-methylpyrimidin-4-yl]-2-(3-ethyl-1H-benzimidazol-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 58955207 |
| Molecular Formula | C19H20N6 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2Z)-2-[2-(cyclopropylamino)-5-methylpyrimidin-4-yl]-2-(3-ethyl-1H-benzimidazol-2-ylidene)acetonitrile |
| SMILES | CCN1/C(=C(\C#N)c2nc(NC3CC3)ncc2C)Nc2ccccc21 |
| InChI | InChI=1S/C19H20N6/c1-3-25-16-7-5-4-6-15(16)23-18(25)14(10-20)17-12(2)11-21-19(24-17)22-13-8-9-13/h4-7,11,13,23H,3,8-9H2,1-2H3,(H,21,22,24)/b18-14+ |
| InChIKey | AHRYUGTWZQRLRB-NBVRZTHBSA-N |
| XLogP | 3.50 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|