C22H24F3NO — CID 58956332
(4aS,5R,10bS)-5-phenyl-9-propan-2-yl-7-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956332) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-phenyl-9-propan-2-yl-7-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-phenyl-9-propan-2-yl-7-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956332 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (4aS,5R,10bS)-5-phenyl-9-propan-2-yl-7-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CC(C)c1cc2c(c(C(F)(F)F)c1)N[C@@H](c1ccccc1)[C@@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C22H24F3NO/c1-13(2)15-11-17-20(18(12-15)22(23,24)25)26-19(14-7-4-3-5-8-14)16-9-6-10-27-21(16)17/h3-5,7-8,11-13,16,19,21,26H,6,9-10H2,1-2H3/t16-,19-,21-/m0/s1 |
| InChIKey | BUMZMDZGEBJKAJ-LRQRDZAKSA-N |
| XLogP | 6.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |