C18H18F3NO2 — CID 58956742
5-(5-methylfuran-2-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956742) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 5-(5-methylfuran-2-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 5-(5-methylfuran-2-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956742 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5-(5-methylfuran-2-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Cc1ccc(C2Nc3ccc(C(F)(F)F)cc3C3OCCCC23)o1 |
| InChI | InChI=1S/C18H18F3NO2/c1-10-4-7-15(24-10)16-12-3-2-8-23-17(12)13-9-11(18(19,20)21)5-6-14(13)22-16/h4-7,9,12,16-17,22H,2-3,8H2,1H3 |
| InChIKey | ZUEYOCILEUYVOS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |