C9H11F3N2O3 — CID 58972822
1-(1-hydroxy-2-methylpropan-2-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 58972822) has the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methylpropan-2-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-(1-hydroxy-2-methylpropan-2-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58972822 |
| Molecular Formula | C9H11F3N2O3 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(1-hydroxy-2-methylpropan-2-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | CC(C)(CO)n1ncc(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O3/c1-8(2,4-15)14-6(9(10,11)12)5(3-13-14)7(16)17/h3,15H,4H2,1-2H3,(H,16,17) |
| InChIKey | VXHZURUXBFIZHL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |