C20H33F3N2O3 — CID 151268474
ethyl 1-(1-hydroxy-2-methylpropan-2-yl)-5-(10,10,10-trifluorodecyl)pyrazole-4-carboxylate (PubChem CID 151268474) has the molecular formula C20H33F3N2O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is ethyl 1-(1-hydroxy-2-methylpropan-2-yl)-5-(10,10,10-trifluorodecyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(1-hydroxy-2-methylpropan-2-yl)-5-(10,10,10-trifluorodecyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 151268474 |
| Molecular Formula | C20H33F3N2O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | ethyl 1-(1-hydroxy-2-methylpropan-2-yl)-5-(10,10,10-trifluorodecyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C(C)(C)CO)c1CCCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C20H33F3N2O3/c1-4-28-18(27)16-14-24-25(19(2,3)15-26)17(16)12-10-8-6-5-7-9-11-13-20(21,22)23/h14,26H,4-13,15H2,1-3H3 |
| InChIKey | NVVRUMXJXRZRTH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|