C20H19IrN2O2+ — CID 58986785
1-hydroxyethylideneoxidanium;iridium;1-methyl-3-(2H-naphthalen-2-id-1-yl)-2H-benzimidazol-2-ylium (PubChem CID 58986785) has the molecular formula C20H19IrN2O2+ and a molecular weight of 511.60 g/mol. Its IUPAC name is 1-hydroxyethylideneoxidanium;iridium;1-methyl-3-(2H-naphthalen-2-id-1-yl)-2H-benzimidazol-2-ylium.
| Compound Name | 1-hydroxyethylideneoxidanium;iridium;1-methyl-3-(2H-naphthalen-2-id-1-yl)-2H-benzimidazol-2-ylium |
|---|---|
| PubChem CID | 58986785 |
| Molecular Formula | C20H19IrN2O2+ |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-hydroxyethylideneoxidanium;iridium;1-methyl-3-(2H-naphthalen-2-id-1-yl)-2H-benzimidazol-2-ylium |
| SMILES | Cn1[cH+]n(-c2[c-]ccc3ccccc23)c2ccccc21.[H]/[O+]=C(\C)O.[Ir] |
| InChI | InChI=1S/C18H14N2.C2H4O2.Ir/c1-19-13-20(18-11-5-4-10-17(18)19)16-12-6-8-14-7-2-3-9-15(14)16;1-2(3)4;/h2-11,13H,1H3;1H3,(H,3,4);/p+1 |
| InChIKey | VSWIJPQUWGOSNU-UHFFFAOYSA-O |
| XLogP | 4.27 |
| TPSA | 51.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|