C13H16N2O3 — CID 58988449
[(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl] N-ethyl-N-methylcarbamate (PubChem CID 58988449) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is [(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl] N-ethyl-N-methylcarbamate.
| Compound Name | [(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl] N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 58988449 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [(3E)-3-hydroxyimino-1,2-dihydroinden-5-yl] N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)Oc1ccc2c(c1)/C(=N/O)CC2 |
| InChI | InChI=1S/C13H16N2O3/c1-3-15(2)13(16)18-10-6-4-9-5-7-12(14-17)11(9)8-10/h4,6,8,17H,3,5,7H2,1-2H3/b14-12+ |
| InChIKey | IZWAIZRBKLEOFY-WYMLVPIESA-N |
| XLogP | 2.26 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|