C43H48O7PS+ — CID 58990952
dibenzyl 3-[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]propyl phosphate (PubChem CID 58990952) has the molecular formula C43H48O7PS+ and a molecular weight of 739.89 g/mol. Its IUPAC name is dibenzyl 3-[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]propyl phosphate.
| Compound Name | dibenzyl 3-[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]propyl phosphate |
|---|---|
| PubChem CID | 58990952 |
| Molecular Formula | C43H48O7PS+ |
| Molecular Weight | 739.89 g/mol |
| Exact Mass | 739.29 |
| IUPAC Name | dibenzyl 3-[(2R,3S,4S)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)thiolan-1-ium-1-yl]propyl phosphate |
| SMILES | O=P(OCCC[S+]1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1COCc1ccccc1)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C43H48O7PS/c44-51(49-32-39-23-12-4-13-24-39,50-33-40-25-14-5-15-26-40)48-27-16-28-52-35-41(46-30-37-19-8-2-9-20-37)43(47-31-38-21-10-3-11-22-38)42(52)34-45-29-36-17-6-1-7-18-36/h1-15,17-26,41-43H,16,27-35H2/q+1/t41-,42-,43+,52?/m1/s1 |
| InChIKey | HJFGOGJDNREQNN-HIAAHVAYSA-N |
| XLogP | 9.32 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.89 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|