C22H28F12O7 — CID 59002292
6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4,6-trimethyloctanoic acid (PubChem CID 59002292) has the molecular formula C22H28F12O7 and a molecular weight of 632.44 g/mol. Its IUPAC name is 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4,6-trimethyloctanoic acid.
| Compound Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4,6-trimethyloctanoic acid |
|---|---|
| PubChem CID | 59002292 |
| Molecular Formula | C22H28F12O7 |
| Molecular Weight | 632.44 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | 6-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxycarbonyl)-4-(2-hydroxyethoxycarbonyl)-2,4,6-trimethyloctanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)C(=O)O)C(=O)OCCO)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C22H28F12O7/c1-5-16(3,9-17(4,8-11(2)12(36)37)15(39)40-7-6-35)14(38)41-10-18(25,26)20(29,30)22(33,34)21(31,32)19(27,28)13(23)24/h11,13,35H,5-10H2,1-4H3,(H,36,37) |
| InChIKey | LUDFUEXDIVZEHZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|