C24H35N2O+ — CID 59004884
[(2E)-2-[1-[3-(2-acetylcyclopentyl)propyl]-3,3-dimethylindol-2-ylidene]ethylidene]-dimethylazanium (PubChem CID 59004884) has the molecular formula C24H35N2O+ and a molecular weight of 367.56 g/mol. Its IUPAC name is [(2E)-2-[1-[3-(2-acetylcyclopentyl)propyl]-3,3-dimethylindol-2-ylidene]ethylidene]-dimethylazanium.
| Compound Name | [(2E)-2-[1-[3-(2-acetylcyclopentyl)propyl]-3,3-dimethylindol-2-ylidene]ethylidene]-dimethylazanium |
|---|---|
| PubChem CID | 59004884 |
| Molecular Formula | C24H35N2O+ |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | [(2E)-2-[1-[3-(2-acetylcyclopentyl)propyl]-3,3-dimethylindol-2-ylidene]ethylidene]-dimethylazanium |
| SMILES | CC(=O)C1CCCC1CCCN1/C(=C/C=[N+](C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H35N2O/c1-18(27)20-12-8-10-19(20)11-9-16-26-22-14-7-6-13-21(22)24(2,3)23(26)15-17-25(4)5/h6-7,13-15,17,19-20H,8-12,16H2,1-5H3/q+1 |
| InChIKey | PVMJOBKOZVEDCH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|