C22H40O7Si — CID 59012154
ethyl 4-[(6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxopentyl]-2-hydroxyoxan-2-yl]-3-oxobutanoate (PubChem CID 59012154) has the molecular formula C22H40O7Si and a molecular weight of 444.64 g/mol. Its IUPAC name is ethyl 4-[(6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxopentyl]-2-hydroxyoxan-2-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[(6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxopentyl]-2-hydroxyoxan-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 59012154 |
| Molecular Formula | C22H40O7Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | ethyl 4-[(6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxopentyl]-2-hydroxyoxan-2-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CC1(O)CCC[C@@H](C[C@H](CC(C)=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H40O7Si/c1-8-27-20(25)13-17(24)15-22(26)11-9-10-18(28-22)14-19(12-16(2)23)29-30(6,7)21(3,4)5/h18-19,26H,8-15H2,1-7H3/t18-,19-,22?/m0/s1 |
| InChIKey | RAZKVNSDBIMICA-NVPCEHRXSA-N |
| XLogP | 3.92 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|