C15H16BN5O3 — CID 59015719
CID 59015719 (PubChem CID 59015719) has the molecular formula C15H16BN5O3 and a molecular weight of 325.14 g/mol.
| Compound Name | CID 59015719 |
|---|---|
| PubChem CID | 59015719 |
| Molecular Formula | C15H16BN5O3 |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCCc2cc(N3C[C@H](CN=[N+]=[N-])OC3=O)ccc2C1 |
| InChI | InChI=1S/C15H16BN5O3/c16-14(22)20-5-1-2-10-6-12(4-3-11(10)8-20)21-9-13(7-18-19-17)24-15(21)23/h3-4,6,13H,1-2,5,7-9H2/t13-/m0/s1 |
| InChIKey | AEDUVIJDKMWQCS-ZDUSSCGKSA-N |
| XLogP | 2.36 |
| TPSA | 98.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|