C16H19BN2O6S — CID 59015706
CID 59015706 (PubChem CID 59015706) has the molecular formula C16H19BN2O6S and a molecular weight of 378.22 g/mol.
| Compound Name | CID 59015706 |
|---|---|
| PubChem CID | 59015706 |
| Molecular Formula | C16H19BN2O6S |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCCc2cc(N3C[C@H](COS(C)(=O)=O)OC3=O)ccc2C1 |
| InChI | InChI=1S/C16H19BN2O6S/c1-26(22,23)24-10-14-9-19(16(21)25-14)13-5-4-12-8-18(15(17)20)6-2-3-11(12)7-13/h4-5,7,14H,2-3,6,8-10H2,1H3/t14-/m1/s1 |
| InChIKey | FBZYCMAITWXCFI-CQSZACIVSA-N |
| XLogP | 1.02 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|