C33H36O6S — CID 59035938
methyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-7-tritylsulfanylheptanoate (PubChem CID 59035938) has the molecular formula C33H36O6S and a molecular weight of 560.71 g/mol. Its IUPAC name is methyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-7-tritylsulfanylheptanoate.
| Compound Name | methyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-7-tritylsulfanylheptanoate |
|---|---|
| PubChem CID | 59035938 |
| Molecular Formula | C33H36O6S |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | methyl 4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-7-tritylsulfanylheptanoate |
| SMILES | COC(=O)CCC(CCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C33H36O6S/c1-32(2)38-30(35)29(31(36)39-32)24(21-22-28(34)37-3)14-13-23-40-33(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27/h4-12,15-20,24,29H,13-14,21-23H2,1-3H3 |
| InChIKey | YWWVGOGEUTXMFY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|