C28H28O4S — CID 11134319
2,2-dimethyl-5-(3-tritylsulfanylpropyl)-1,3-dioxane-4,6-dione (PubChem CID 11134319) has the molecular formula C28H28O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-tritylsulfanylpropyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(3-tritylsulfanylpropyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11134319 |
| Molecular Formula | C28H28O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2,2-dimethyl-5-(3-tritylsulfanylpropyl)-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(CCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C28H28O4S/c1-27(2)31-25(29)24(26(30)32-27)19-12-20-33-28(21-13-6-3-7-14-21,22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-11,13-18,24H,12,19-20H2,1-2H3 |
| InChIKey | RWQDWWVQXIIQEU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|