C32H34O6S — CID 11082151
methyl 3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoate (PubChem CID 11082151) has the molecular formula C32H34O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is methyl 3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoate.
| Compound Name | methyl 3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoate |
|---|---|
| PubChem CID | 11082151 |
| Molecular Formula | C32H34O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | methyl 3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoate |
| SMILES | COC(=O)CCC1(CCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C32H34O6S/c1-30(2)37-28(34)31(29(35)38-30,22-20-27(33)36-3)21-13-23-39-32(24-14-7-4-8-15-24,25-16-9-5-10-17-25)26-18-11-6-12-19-26/h4-12,14-19H,13,20-23H2,1-3H3 |
| InChIKey | LZICFINGWPMWMI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|