C40H51F3O4S — CID 162700739
5-O-methyl 1-O-[3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate (PubChem CID 162700739) has the molecular formula C40H51F3O4S and a molecular weight of 684.90 g/mol. Its IUPAC name is 5-O-methyl 1-O-[3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate.
| Compound Name | 5-O-methyl 1-O-[3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate |
|---|---|
| PubChem CID | 162700739 |
| Molecular Formula | C40H51F3O4S |
| Molecular Weight | 684.90 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | 5-O-methyl 1-O-[3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate |
| SMILES | CCC(C)CC(CC(CC(C)(CC(C)C(=O)OC)C(=O)OCCCSCC(F)(F)F)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H51F3O4S/c1-6-30(2)25-33(32-17-10-7-11-18-32)27-39(34-19-12-8-13-20-34,35-21-14-9-15-22-35)28-38(4,26-31(3)36(44)46-5)37(45)47-23-16-24-48-29-40(41,42)43/h7-15,17-22,30-31,33H,6,16,23-29H2,1-5H3 |
| InChIKey | WMOPXTVRNFBQLB-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.90 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|