C36H38N3O4+ — CID 59038679
2-[(1E,3Z,5E,7Z)-7-[5-(hydroperoxymethyl)-1,3,3-trimethylindol-2-ylidene]-4-pyridin-4-ylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid (PubChem CID 59038679) has the molecular formula C36H38N3O4+ and a molecular weight of 576.72 g/mol. Its IUPAC name is 2-[(1E,3Z,5E,7Z)-7-[5-(hydroperoxymethyl)-1,3,3-trimethylindol-2-ylidene]-4-pyridin-4-ylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid.
| Compound Name | 2-[(1E,3Z,5E,7Z)-7-[5-(hydroperoxymethyl)-1,3,3-trimethylindol-2-ylidene]-4-pyridin-4-ylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 59038679 |
| Molecular Formula | C36H38N3O4+ |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 2-[(1E,3Z,5E,7Z)-7-[5-(hydroperoxymethyl)-1,3,3-trimethylindol-2-ylidene]-4-pyridin-4-ylhepta-1,3,5-trienyl]-1,3,3-trimethylindol-1-ium-5-carboxylic acid |
| SMILES | CN1/C(=C\C=C\C(=C\C=C\C2=[N+](C)c3ccc(C(=O)O)cc3C2(C)C)c2ccncc2)C(C)(C)c2cc(COO)ccc21 |
| InChI | InChI=1S/C36H37N3O4/c1-35(2)28-21-24(23-43-42)13-15-30(28)38(5)32(35)11-7-9-25(26-17-19-37-20-18-26)10-8-12-33-36(3,4)29-22-27(34(40)41)14-16-31(29)39(33)6/h7-22H,23H2,1-6H3,(H-,40,41,42)/p+1 |
| InChIKey | VQPGPNMXZZWRLQ-UHFFFAOYSA-O |
| XLogP | 7.28 |
| TPSA | 85.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|